C23H31N7 — CID 143260391
1-cyclohexyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 143260391) has the molecular formula C23H31N7 and a molecular weight of 405.55 g/mol. Its IUPAC name is 1-cyclohexyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-cyclohexyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 143260391 |
| Molecular Formula | C23H31N7 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 1-cyclohexyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | Cc1cc(Nc2ncc3cnn(C4CCCCC4)c3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C23H31N7/c1-17-14-19(8-9-21(17)29-12-10-28(2)11-13-29)26-23-24-15-18-16-25-30(22(18)27-23)20-6-4-3-5-7-20/h8-9,14-16,20H,3-7,10-13H2,1-2H3,(H,24,26,27) |
| InChIKey | WYRWYTANALEFAU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|