C22H27N5O — CID 143730565
1-[4-[(1-cycloheptylpyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]-2-methylprop-1-en-1-ol (PubChem CID 143730565) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[4-[(1-cycloheptylpyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]-2-methylprop-1-en-1-ol.
| Compound Name | 1-[4-[(1-cycloheptylpyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]-2-methylprop-1-en-1-ol |
|---|---|
| PubChem CID | 143730565 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-[4-[(1-cycloheptylpyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]-2-methylprop-1-en-1-ol |
| SMILES | CC(C)=C(O)c1ccc(Nc2ncc3cnn(C4CCCCCC4)c3n2)cc1 |
| InChI | InChI=1S/C22H27N5O/c1-15(2)20(28)16-9-11-18(12-10-16)25-22-23-13-17-14-24-27(21(17)26-22)19-7-5-3-4-6-8-19/h9-14,19,28H,3-8H2,1-2H3,(H,23,25,26) |
| InChIKey | SAVIKZNHJKNHBN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|