C20H27N7O2S — CID 24958986
1-cycloheptyl-6-[4-(dimethylsulfamoylamino)anilino]pyrazolo[3,4-d]pyrimidine (PubChem CID 24958986) has the molecular formula C20H27N7O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is 1-cycloheptyl-6-[4-(dimethylsulfamoylamino)anilino]pyrazolo[3,4-d]pyrimidine.
| Compound Name | 1-cycloheptyl-6-[4-(dimethylsulfamoylamino)anilino]pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 24958986 |
| Molecular Formula | C20H27N7O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-cycloheptyl-6-[4-(dimethylsulfamoylamino)anilino]pyrazolo[3,4-d]pyrimidine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(Nc2ncc3cnn(C4CCCCCC4)c3n2)cc1 |
| InChI | InChI=1S/C20H27N7O2S/c1-26(2)30(28,29)25-17-11-9-16(10-12-17)23-20-21-13-15-14-22-27(19(15)24-20)18-7-5-3-4-6-8-18/h9-14,18,25H,3-8H2,1-2H3,(H,21,23,24) |
| InChIKey | UTZTVRSMENETRF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |