C18H30N4O2S — CID 112502794
1-cyclohexyl-4-[4-(dimethylsulfamoylamino)phenyl]piperazine (PubChem CID 112502794) has the molecular formula C18H30N4O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is 1-cyclohexyl-4-[4-(dimethylsulfamoylamino)phenyl]piperazine.
| Compound Name | 1-cyclohexyl-4-[4-(dimethylsulfamoylamino)phenyl]piperazine |
|---|---|
| PubChem CID | 112502794 |
| Molecular Formula | C18H30N4O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-cyclohexyl-4-[4-(dimethylsulfamoylamino)phenyl]piperazine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H30N4O2S/c1-20(2)25(23,24)19-16-8-10-18(11-9-16)22-14-12-21(13-15-22)17-6-4-3-5-7-17/h8-11,17,19H,3-7,12-15H2,1-2H3 |
| InChIKey | UMYCSZAXNOKQBI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|