C22H29N3O2S — CID 110288099
N-[4-(4-cyclopropylpiperazin-1-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 110288099) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[4-(4-cyclopropylpiperazin-1-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[4-(4-cyclopropylpiperazin-1-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110288099 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[4-(4-cyclopropylpiperazin-1-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(N3CCN(C4CC4)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H29N3O2S/c1-16-14-17(2)22(18(3)15-16)28(26,27)23-19-4-6-20(7-5-19)24-10-12-25(13-11-24)21-8-9-21/h4-7,14-15,21,23H,8-13H2,1-3H3 |
| InChIKey | FPAGLCYCYWHNCK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|