C23H32N4O3S — CID 78792145
N-[4-(4-methylpiperazin-1-yl)phenyl]-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide (PubChem CID 78792145) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 78792145 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCC(=O)Nc2ccc(N3CCN(C)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H32N4O3S/c1-17-15-18(2)23(19(3)16-17)31(29,30)24-10-9-22(28)25-20-5-7-21(8-6-20)27-13-11-26(4)12-14-27/h5-8,15-16,24H,9-14H2,1-4H3,(H,25,28) |
| InChIKey | DTVOMORVKVUUOD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|