C21H29N3O2S — CID 42267382
2,4,6-trimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide (PubChem CID 42267382) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42267382 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2,4,6-trimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCN2CCN(c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H29N3O2S/c1-17-15-18(2)21(19(3)16-17)27(25,26)22-9-10-23-11-13-24(14-12-23)20-7-5-4-6-8-20/h4-8,15-16,22H,9-14H2,1-3H3 |
| InChIKey | CLULGLFUJMAFHE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |