C18H21F2N3O2S — CID 42428630
3,4-difluoro-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide (PubChem CID 42428630) has the molecular formula C18H21F2N3O2S and a molecular weight of 381.45 g/mol. Its IUPAC name is 3,4-difluoro-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42428630 |
| Molecular Formula | C18H21F2N3O2S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3,4-difluoro-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCN1CCN(c2ccccc2)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H21F2N3O2S/c19-17-7-6-16(14-18(17)20)26(24,25)21-8-9-22-10-12-23(13-11-22)15-4-2-1-3-5-15/h1-7,14,21H,8-13H2 |
| InChIKey | NVIATPOMHBFNGQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |