C20H27N3O2S — CID 42389147
3-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide (PubChem CID 42389147) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 3-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 3-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42389147 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3-methyl-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NCCCN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H27N3O2S/c1-18-7-5-10-20(17-18)26(24,25)21-11-6-12-22-13-15-23(16-14-22)19-8-3-2-4-9-19/h2-5,7-10,17,21H,6,11-16H2,1H3 |
| InChIKey | VWYOUJPOXPSJPQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|