C24H33N3O2S — CID 34266967
N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 34266967) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 34266967 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | Cc1cccc(N2CCN(CCCNS(=O)(=O)c3ccc4c(c3)CCCC4)CC2)c1 |
| InChI | InChI=1S/C24H33N3O2S/c1-20-6-4-9-23(18-20)27-16-14-26(15-17-27)13-5-12-25-30(28,29)24-11-10-21-7-2-3-8-22(21)19-24/h4,6,9-11,18-19,25H,2-3,5,7-8,12-17H2,1H3 |
| InChIKey | XFRKTWHWQVDNSQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|