C23H31N3O2S — CID 16890289
N-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 16890289) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is N-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 16890289 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | CN1CCN(c2ccc(CCNS(=O)(=O)c3ccc4c(c3)CCCC4)cc2)CC1 |
| InChI | InChI=1S/C23H31N3O2S/c1-25-14-16-26(17-15-25)22-9-6-19(7-10-22)12-13-24-29(27,28)23-11-8-20-4-2-3-5-21(20)18-23/h6-11,18,24H,2-5,12-17H2,1H3 |
| InChIKey | FCBLHYOPOPRXOX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|