C19H24FN3O2S — CID 16890263
4-fluoro-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]benzenesulfonamide (PubChem CID 16890263) has the molecular formula C19H24FN3O2S and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-fluoro-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16890263 |
| Molecular Formula | C19H24FN3O2S |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-fluoro-N-[2-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]benzenesulfonamide |
| SMILES | CN1CCN(c2ccc(CCNS(=O)(=O)c3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C19H24FN3O2S/c1-22-12-14-23(15-13-22)18-6-2-16(3-7-18)10-11-21-26(24,25)19-8-4-17(20)5-9-19/h2-9,21H,10-15H2,1H3 |
| InChIKey | XLFGVQVPEJGWGN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|