C26H28FN3O4S — CID 2942380
4-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 2942380) has the molecular formula C26H28FN3O4S and a molecular weight of 497.59 g/mol. Its IUPAC name is 4-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 4-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2942380 |
| Molecular Formula | C26H28FN3O4S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 4-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)NCCc2ccccc2)cc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H28FN3O4S/c27-22-6-8-23(9-7-22)29-16-18-30(19-17-29)26(31)20-34-24-10-12-25(13-11-24)35(32,33)28-15-14-21-4-2-1-3-5-21/h1-13,28H,14-20H2 |
| InChIKey | PACXXHKVLMVJSC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |