C22H26FN3O4S — CID 45374724
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethanone (PubChem CID 45374724) has the molecular formula C22H26FN3O4S and a molecular weight of 447.53 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 45374724 |
| Molecular Formula | C22H26FN3O4S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethanone |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCCC2)cc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H26FN3O4S/c23-18-3-5-19(6-4-18)24-13-15-25(16-14-24)22(27)17-30-20-7-9-21(10-8-20)31(28,29)26-11-1-2-12-26/h3-10H,1-2,11-17H2 |
| InChIKey | OIABMAFKNJXVNN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |