C22H26FN3O5S — CID 27125800
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone (PubChem CID 27125800) has the molecular formula C22H26FN3O5S and a molecular weight of 463.53 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
|---|---|
| PubChem CID | 27125800 |
| Molecular Formula | C22H26FN3O5S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(4-morpholin-4-ylsulfonylphenoxy)ethanone |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCOCC2)cc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H26FN3O5S/c23-18-1-3-19(4-2-18)24-9-11-25(12-10-24)22(27)17-31-20-5-7-21(8-6-20)32(28,29)26-13-15-30-16-14-26/h1-8H,9-17H2 |
| InChIKey | MUQJTZJJWZDRMV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |