C25H31N3O5S — CID 45372569
2-(4-morpholin-4-ylsulfonylphenoxy)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethanone (PubChem CID 45372569) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylsulfonylphenoxy)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(4-morpholin-4-ylsulfonylphenoxy)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 45372569 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-(4-morpholin-4-ylsulfonylphenoxy)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethanone |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCOCC2)cc1)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C25H31N3O5S/c29-25(27-15-13-26(14-16-27)12-4-7-22-5-2-1-3-6-22)21-33-23-8-10-24(11-9-23)34(30,31)28-17-19-32-20-18-28/h1-11H,12-21H2/b7-4+ |
| InChIKey | HLRCMWZNZOWJST-QPJJXVBHSA-N |
| XLogP | 1.94 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |