C20H26ClN3O2S — CID 16890704
4-chloro-N-[3-[4-(4-methylpiperazin-1-yl)phenyl]propyl]benzenesulfonamide (PubChem CID 16890704) has the molecular formula C20H26ClN3O2S and a molecular weight of 407.97 g/mol. Its IUPAC name is 4-chloro-N-[3-[4-(4-methylpiperazin-1-yl)phenyl]propyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-[4-(4-methylpiperazin-1-yl)phenyl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16890704 |
| Molecular Formula | C20H26ClN3O2S |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-chloro-N-[3-[4-(4-methylpiperazin-1-yl)phenyl]propyl]benzenesulfonamide |
| SMILES | CN1CCN(c2ccc(CCCNS(=O)(=O)c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H26ClN3O2S/c1-23-13-15-24(16-14-23)19-8-4-17(5-9-19)3-2-12-22-27(25,26)20-10-6-18(21)7-11-20/h4-11,22H,2-3,12-16H2,1H3 |
| InChIKey | GZBHNHXWPYJJFJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|