C20H27N3O2S — CID 110405209
3,4-dimethyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 110405209) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 3,4-dimethyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110405209 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3,4-dimethyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccc(N3CCN(C)CC3)cc2)cc1C |
| InChI | InChI=1S/C20H27N3O2S/c1-16-4-9-20(14-17(16)2)26(24,25)21-15-18-5-7-19(8-6-18)23-12-10-22(3)11-13-23/h4-9,14,21H,10-13,15H2,1-3H3 |
| InChIKey | RTGZCXCKWUQAEA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|