C20H24N4O3S2 — CID 100721474
3-methyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100721474) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 3-methyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-methyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100721474 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3-methyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | CN1CCN(c2ccc(CNS(=O)(=O)c3ccc4c(c3)sc(=O)n4C)cc2)CC1 |
| InChI | InChI=1S/C20H24N4O3S2/c1-22-9-11-24(12-10-22)16-5-3-15(4-6-16)14-21-29(26,27)17-7-8-18-19(13-17)28-20(25)23(18)2/h3-8,13,21H,9-12,14H2,1-2H3 |
| InChIKey | KESOGGZXHNRNPX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|