C26H26ClN3O3S2 — CID 100752016
3-[(4-chlorophenyl)methyl]-2-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-1,3-benzothiazole-6-sulfonamide (PubChem CID 100752016) has the molecular formula C26H26ClN3O3S2 and a molecular weight of 528.10 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-2-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-2-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100752016 |
| Molecular Formula | C26H26ClN3O3S2 |
| Molecular Weight | 528.10 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-2-oxo-N-[(4-piperidin-1-ylphenyl)methyl]-1,3-benzothiazole-6-sulfonamide |
| SMILES | O=c1sc2cc(S(=O)(=O)NCc3ccc(N4CCCCC4)cc3)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H26ClN3O3S2/c27-21-8-4-20(5-9-21)18-30-24-13-12-23(16-25(24)34-26(30)31)35(32,33)28-17-19-6-10-22(11-7-19)29-14-2-1-3-15-29/h4-13,16,28H,1-3,14-15,17-18H2 |
| InChIKey | GCSJWSUCQGCPPK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.10 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|