C27H29N3O3S2 — CID 100743213
3-benzyl-2-oxo-N-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]-1,3-benzothiazole-6-sulfonamide (PubChem CID 100743213) has the molecular formula C27H29N3O3S2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 3-benzyl-2-oxo-N-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-benzyl-2-oxo-N-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100743213 |
| Molecular Formula | C27H29N3O3S2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 3-benzyl-2-oxo-N-[(1R)-1-(4-piperidin-1-ylphenyl)ethyl]-1,3-benzothiazole-6-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc2c(c1)sc(=O)n2Cc1ccccc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C27H29N3O3S2/c1-20(22-10-12-23(13-11-22)29-16-6-3-7-17-29)28-35(32,33)24-14-15-25-26(18-24)34-27(31)30(25)19-21-8-4-2-5-9-21/h2,4-5,8-15,18,20,28H,3,6-7,16-17,19H2,1H3/t20-/m1/s1 |
| InChIKey | CJSPRRDZMYGHAR-HXUWFJFHSA-N |
| XLogP | 5.14 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|