C28H30ClN3O3S2 — CID 125059084
3-[(4-chlorophenyl)methyl]-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 125059084) has the molecular formula C28H30ClN3O3S2 and a molecular weight of 556.15 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 125059084 |
| Molecular Formula | C28H30ClN3O3S2 |
| Molecular Weight | 556.15 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | C[C@H]1CCCN(c2ccc([C@H](C)NS(=O)(=O)c3ccc4c(c3)sc(=O)n4Cc3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C28H30ClN3O3S2/c1-19-4-3-15-31(17-19)24-11-7-22(8-12-24)20(2)30-37(34,35)25-13-14-26-27(16-25)36-28(33)32(26)18-21-5-9-23(29)10-6-21/h5-14,16,19-20,30H,3-4,15,17-18H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | OFKAJHYZRZKAMI-PMACEKPBSA-N |
| XLogP | 6.04 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.15 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|