C23H28ClN3O3S2 — CID 100753339
3-[(4-chlorophenyl)methyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100753339) has the molecular formula C23H28ClN3O3S2 and a molecular weight of 494.08 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100753339 |
| Molecular Formula | C23H28ClN3O3S2 |
| Molecular Weight | 494.08 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | C[C@@H]1CCCN(CCCNS(=O)(=O)c2ccc3c(c2)sc(=O)n3Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H28ClN3O3S2/c1-17-4-2-12-26(15-17)13-3-11-25-32(29,30)20-9-10-21-22(14-20)31-23(28)27(21)16-18-5-7-19(24)8-6-18/h5-10,14,17,25H,2-4,11-13,15-16H2,1H3/t17-/m1/s1 |
| InChIKey | QAHKCQMSZVUHBH-QGZVFWFLSA-N |
| XLogP | 4.16 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.08 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|