C25H25ClN4O3S2 — CID 100753398
3-[(4-chlorophenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100753398) has the molecular formula C25H25ClN4O3S2 and a molecular weight of 529.09 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100753398 |
| Molecular Formula | C25H25ClN4O3S2 |
| Molecular Weight | 529.09 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | CN1CCN(c2ccc(NS(=O)(=O)c3ccc4c(c3)sc(=O)n4Cc3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H25ClN4O3S2/c1-28-12-14-29(15-13-28)21-8-6-20(7-9-21)27-35(32,33)22-10-11-23-24(16-22)34-25(31)30(23)17-18-2-4-19(26)5-3-18/h2-11,16,27H,12-15,17H2,1H3 |
| InChIKey | CRIPWJJGDZYDON-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.09 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|