C20H14ClN3O5S2 — CID 100751319
3-[(4-chlorophenyl)methyl]-N-(3-nitrophenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100751319) has the molecular formula C20H14ClN3O5S2 and a molecular weight of 475.94 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-N-(3-nitrophenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-[(4-chlorophenyl)methyl]-N-(3-nitrophenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100751319 |
| Molecular Formula | C20H14ClN3O5S2 |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-N-(3-nitrophenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | O=c1sc2cc(S(=O)(=O)Nc3cccc([N+](=O)[O-])c3)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14ClN3O5S2/c21-14-6-4-13(5-7-14)12-23-18-9-8-17(11-19(18)30-20(23)25)31(28,29)22-15-2-1-3-16(10-15)24(26)27/h1-11,22H,12H2 |
| InChIKey | FSDFBUGIOBFNNR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|