C21H16ClN3O5S2 — CID 100755120
3-[(2-chlorophenyl)methyl]-N-(2-methyl-5-nitrophenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide (PubChem CID 100755120) has the molecular formula C21H16ClN3O5S2 and a molecular weight of 489.96 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-N-(2-methyl-5-nitrophenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-N-(2-methyl-5-nitrophenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100755120 |
| Molecular Formula | C21H16ClN3O5S2 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-N-(2-methyl-5-nitrophenyl)-2-oxo-1,3-benzothiazole-6-sulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NS(=O)(=O)c1ccc2c(c1)sc(=O)n2Cc1ccccc1Cl |
| InChI | InChI=1S/C21H16ClN3O5S2/c1-13-6-7-15(25(27)28)10-18(13)23-32(29,30)16-8-9-19-20(11-16)31-21(26)24(19)12-14-4-2-3-5-17(14)22/h2-11,23H,12H2,1H3 |
| InChIKey | JLIHCLOWJBWWJR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|