C19H19ClN2O3S2 — CID 100754031
3-[(2-chlorophenyl)methyl]-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-one (PubChem CID 100754031) has the molecular formula C19H19ClN2O3S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-one.
| Compound Name | 3-[(2-chlorophenyl)methyl]-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 100754031 |
| Molecular Formula | C19H19ClN2O3S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-one |
| SMILES | O=c1sc2cc(S(=O)(=O)N3CCCCC3)ccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C19H19ClN2O3S2/c20-16-7-3-2-6-14(16)13-22-17-9-8-15(12-18(17)26-19(22)23)27(24,25)21-10-4-1-5-11-21/h2-3,6-9,12H,1,4-5,10-11,13H2 |
| InChIKey | SMTBEMNNZKCMRW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |