C20H22N2O3S2 — CID 100741913
3-benzyl-6-[(3S)-3-methylpiperidin-1-yl]sulfonyl-1,3-benzothiazol-2-one (PubChem CID 100741913) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 3-benzyl-6-[(3S)-3-methylpiperidin-1-yl]sulfonyl-1,3-benzothiazol-2-one.
| Compound Name | 3-benzyl-6-[(3S)-3-methylpiperidin-1-yl]sulfonyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 100741913 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-benzyl-6-[(3S)-3-methylpiperidin-1-yl]sulfonyl-1,3-benzothiazol-2-one |
| SMILES | C[C@H]1CCCN(S(=O)(=O)c2ccc3c(c2)sc(=O)n3Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-15-6-5-11-21(13-15)27(24,25)17-9-10-18-19(12-17)26-20(23)22(18)14-16-7-3-2-4-8-16/h2-4,7-10,12,15H,5-6,11,13-14H2,1H3/t15-/m0/s1 |
| InChIKey | TXHSBKUZWXDGQA-HNNXBMFYSA-N |
| XLogP | 3.53 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |