C26H27N3O3S2 — CID 100742609
3-benzyl-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonyl-1,3-benzothiazol-2-one (PubChem CID 100742609) has the molecular formula C26H27N3O3S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is 3-benzyl-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonyl-1,3-benzothiazol-2-one.
| Compound Name | 3-benzyl-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 100742609 |
| Molecular Formula | C26H27N3O3S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 3-benzyl-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonyl-1,3-benzothiazol-2-one |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)c3ccc4c(c3)sc(=O)n4Cc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C26H27N3O3S2/c1-19-7-6-10-23(20(19)2)27-13-15-28(16-14-27)34(31,32)22-11-12-24-25(17-22)33-26(30)29(24)18-21-8-4-3-5-9-21/h3-12,17H,13-16,18H2,1-2H3 |
| InChIKey | SMPGNZKHPWYXFW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |