C18H21IN2O2S — CID 3590123
1-(2,3-dimethylphenyl)-4-(4-iodophenyl)sulfonylpiperazine (PubChem CID 3590123) has the molecular formula C18H21IN2O2S and a molecular weight of 456.35 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-4-(4-iodophenyl)sulfonylpiperazine.
| Compound Name | 1-(2,3-dimethylphenyl)-4-(4-iodophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 3590123 |
| Molecular Formula | C18H21IN2O2S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-4-(4-iodophenyl)sulfonylpiperazine |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)c3ccc(I)cc3)CC2)c1C |
| InChI | InChI=1S/C18H21IN2O2S/c1-14-4-3-5-18(15(14)2)20-10-12-21(13-11-20)24(22,23)17-8-6-16(19)7-9-17/h3-9H,10-13H2,1-2H3 |
| InChIKey | BFPRSNHFUVCUQK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|