C14H23N3O2S — CID 742913
4-(2,3-dimethylphenyl)-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 742913) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-(2,3-dimethylphenyl)-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 742913 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)N(C)C)CC2)c1C |
| InChI | InChI=1S/C14H23N3O2S/c1-12-6-5-7-14(13(12)2)16-8-10-17(11-9-16)20(18,19)15(3)4/h5-7H,8-11H2,1-4H3 |
| InChIKey | OFLCNZDZICIJOT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |