C16H19ClN2O2S2 — CID 3382446
1-(5-chlorothiophen-2-yl)sulfonyl-4-(2,3-dimethylphenyl)piperazine (PubChem CID 3382446) has the molecular formula C16H19ClN2O2S2 and a molecular weight of 370.93 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-4-(2,3-dimethylphenyl)piperazine.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-(2,3-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 3382446 |
| Molecular Formula | C16H19ClN2O2S2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-(2,3-dimethylphenyl)piperazine |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)c1C |
| InChI | InChI=1S/C16H19ClN2O2S2/c1-12-4-3-5-14(13(12)2)18-8-10-19(11-9-18)23(20,21)16-7-6-15(17)22-16/h3-7H,8-11H2,1-2H3 |
| InChIKey | MLTBTANNDXIXQN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |