C22H23ClN2O2S — CID 3520156
1-(8-chloronaphthalen-1-yl)sulfonyl-4-(2,3-dimethylphenyl)piperazine (PubChem CID 3520156) has the molecular formula C22H23ClN2O2S and a molecular weight of 414.96 g/mol. Its IUPAC name is 1-(8-chloronaphthalen-1-yl)sulfonyl-4-(2,3-dimethylphenyl)piperazine.
| Compound Name | 1-(8-chloronaphthalen-1-yl)sulfonyl-4-(2,3-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 3520156 |
| Molecular Formula | C22H23ClN2O2S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-(8-chloronaphthalen-1-yl)sulfonyl-4-(2,3-dimethylphenyl)piperazine |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)c3cccc4cccc(Cl)c34)CC2)c1C |
| InChI | InChI=1S/C22H23ClN2O2S/c1-16-6-3-10-20(17(16)2)24-12-14-25(15-13-24)28(26,27)21-11-5-8-18-7-4-9-19(23)22(18)21/h3-11H,12-15H2,1-2H3 |
| InChIKey | IIOKEYFGHLLXER-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |