C18H20N4O2S2 — CID 3459018
4-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonyl-2,1,3-benzothiadiazole (PubChem CID 3459018) has the molecular formula C18H20N4O2S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonyl-2,1,3-benzothiadiazole.
| Compound Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 3459018 |
| Molecular Formula | C18H20N4O2S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonyl-2,1,3-benzothiadiazole |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)c3cccc4nsnc34)CC2)c1C |
| InChI | InChI=1S/C18H20N4O2S2/c1-13-5-3-7-16(14(13)2)21-9-11-22(12-10-21)26(23,24)17-8-4-6-15-18(17)20-25-19-15/h3-8H,9-12H2,1-2H3 |
| InChIKey | HNUBIHWJIPCDEH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_B(5)', 'substructure': 'N/A'} |
|---|