C19H21N3O2S — CID 3436716
4-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 3436716) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 3436716 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)c3ccc(C#N)cc3)CC2)c1C |
| InChI | InChI=1S/C19H21N3O2S/c1-15-4-3-5-19(16(15)2)21-10-12-22(13-11-21)25(23,24)18-8-6-17(14-20)7-9-18/h3-9H,10-13H2,1-2H3 |
| InChIKey | JGSXFZBKZFNWID-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |