C22H30N2O2S — CID 19682911
1-(4-butan-2-ylphenyl)sulfonyl-4-(2,3-dimethylphenyl)piperazine (PubChem CID 19682911) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)sulfonyl-4-(2,3-dimethylphenyl)piperazine.
| Compound Name | 1-(4-butan-2-ylphenyl)sulfonyl-4-(2,3-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 19682911 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)sulfonyl-4-(2,3-dimethylphenyl)piperazine |
| SMILES | CCC(C)c1ccc(S(=O)(=O)N2CCN(c3cccc(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C22H30N2O2S/c1-5-17(2)20-9-11-21(12-10-20)27(25,26)24-15-13-23(14-16-24)22-8-6-7-18(3)19(22)4/h6-12,17H,5,13-16H2,1-4H3 |
| InChIKey | UDJRBMXRWMIFOM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |