C18H30N2O4S2 — CID 27522527
1-[4-[(2S)-butan-2-yl]phenyl]sulfonyl-4-butylsulfonylpiperazine (PubChem CID 27522527) has the molecular formula C18H30N2O4S2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 1-[4-[(2S)-butan-2-yl]phenyl]sulfonyl-4-butylsulfonylpiperazine.
| Compound Name | 1-[4-[(2S)-butan-2-yl]phenyl]sulfonyl-4-butylsulfonylpiperazine |
|---|---|
| PubChem CID | 27522527 |
| Molecular Formula | C18H30N2O4S2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-[4-[(2S)-butan-2-yl]phenyl]sulfonyl-4-butylsulfonylpiperazine |
| SMILES | CCCCS(=O)(=O)N1CCN(S(=O)(=O)c2ccc([C@@H](C)CC)cc2)CC1 |
| InChI | InChI=1S/C18H30N2O4S2/c1-4-6-15-25(21,22)19-11-13-20(14-12-19)26(23,24)18-9-7-17(8-10-18)16(3)5-2/h7-10,16H,4-6,11-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | KDSSPBLPLMWQDO-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |