C16H27ClN2O2S — CID 119963645
[1-(4-butan-2-ylphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride (PubChem CID 119963645) has the molecular formula C16H27ClN2O2S and a molecular weight of 346.92 g/mol. Its IUPAC name is [1-(4-butan-2-ylphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride.
| Compound Name | [1-(4-butan-2-ylphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119963645 |
| Molecular Formula | C16H27ClN2O2S |
| Molecular Weight | 346.92 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [1-(4-butan-2-ylphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride |
| SMILES | CCC(C)c1ccc(S(=O)(=O)N2CCC(CN)CC2)cc1.Cl |
| InChI | InChI=1S/C16H26N2O2S.ClH/c1-3-13(2)15-4-6-16(7-5-15)21(19,20)18-10-8-14(12-17)9-11-18;/h4-7,13-14H,3,8-12,17H2,1-2H3;1H |
| InChIKey | NNRXLRCMEKLAHZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.92 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |