C21H28N2O4S2 — CID 40952437
N-[1-[4-[(2S)-butan-2-yl]phenyl]sulfonylpiperidin-4-yl]benzenesulfonamide (PubChem CID 40952437) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[1-[4-[(2S)-butan-2-yl]phenyl]sulfonylpiperidin-4-yl]benzenesulfonamide.
| Compound Name | N-[1-[4-[(2S)-butan-2-yl]phenyl]sulfonylpiperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 40952437 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[1-[4-[(2S)-butan-2-yl]phenyl]sulfonylpiperidin-4-yl]benzenesulfonamide |
| SMILES | CC[C@H](C)c1ccc(S(=O)(=O)N2CCC(NS(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H28N2O4S2/c1-3-17(2)18-9-11-21(12-10-18)29(26,27)23-15-13-19(14-16-23)22-28(24,25)20-7-5-4-6-8-20/h4-12,17,19,22H,3,13-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | OCMXVTMJECOQQM-KRWDZBQOSA-N |
| XLogP | 3.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |