C18H31ClN2O2S — CID 119990196
N-[[1-(4-butan-2-ylphenyl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride (PubChem CID 119990196) has the molecular formula C18H31ClN2O2S and a molecular weight of 374.98 g/mol. Its IUPAC name is N-[[1-(4-butan-2-ylphenyl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride.
| Compound Name | N-[[1-(4-butan-2-ylphenyl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119990196 |
| Molecular Formula | C18H31ClN2O2S |
| Molecular Weight | 374.98 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-[[1-(4-butan-2-ylphenyl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride |
| SMILES | CCNCC1CCN(S(=O)(=O)c2ccc(C(C)CC)cc2)CC1.Cl |
| InChI | InChI=1S/C18H30N2O2S.ClH/c1-4-15(3)17-6-8-18(9-7-17)23(21,22)20-12-10-16(11-13-20)14-19-5-2;/h6-9,15-16,19H,4-5,10-14H2,1-3H3;1H |
| InChIKey | NOVZVQQJYVJMMZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.98 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |