C18H21BrN2O4S2 — CID 55483004
N-[1-(4-bromo-3-methylphenyl)sulfonylpiperidin-4-yl]benzenesulfonamide (PubChem CID 55483004) has the molecular formula C18H21BrN2O4S2 and a molecular weight of 473.41 g/mol. Its IUPAC name is N-[1-(4-bromo-3-methylphenyl)sulfonylpiperidin-4-yl]benzenesulfonamide.
| Compound Name | N-[1-(4-bromo-3-methylphenyl)sulfonylpiperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 55483004 |
| Molecular Formula | C18H21BrN2O4S2 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | N-[1-(4-bromo-3-methylphenyl)sulfonylpiperidin-4-yl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(NS(=O)(=O)c3ccccc3)CC2)ccc1Br |
| InChI | InChI=1S/C18H21BrN2O4S2/c1-14-13-17(7-8-18(14)19)27(24,25)21-11-9-15(10-12-21)20-26(22,23)16-5-3-2-4-6-16/h2-8,13,15,20H,9-12H2,1H3 |
| InChIKey | VGOQTEZBQBMWGV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |