C14H17BrN2O2S — CID 134362277
4-bromo-N-(4-cyanocyclohexyl)-3-methylbenzenesulfonamide (PubChem CID 134362277) has the molecular formula C14H17BrN2O2S and a molecular weight of 357.27 g/mol. Its IUPAC name is 4-bromo-N-(4-cyanocyclohexyl)-3-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-(4-cyanocyclohexyl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134362277 |
| Molecular Formula | C14H17BrN2O2S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 4-bromo-N-(4-cyanocyclohexyl)-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCC(C#N)CC2)ccc1Br |
| InChI | InChI=1S/C14H17BrN2O2S/c1-10-8-13(6-7-14(10)15)20(18,19)17-12-4-2-11(9-16)3-5-12/h6-8,11-12,17H,2-5H2,1H3 |
| InChIKey | UYVHCGFTVHMGMK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |