C14H22N3O4S2+ — CID 7130388
N-cyclopropyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonylbenzenesulfonamide (PubChem CID 7130388) has the molecular formula C14H22N3O4S2+ and a molecular weight of 360.48 g/mol. Its IUPAC name is N-cyclopropyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonylbenzenesulfonamide.
| Compound Name | N-cyclopropyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 7130388 |
| Molecular Formula | C14H22N3O4S2+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-cyclopropyl-4-(4-methylpiperazin-4-ium-1-yl)sulfonylbenzenesulfonamide |
| SMILES | C[NH+]1CCN(S(=O)(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)CC1 |
| InChI | InChI=1S/C14H21N3O4S2/c1-16-8-10-17(11-9-16)23(20,21)14-6-4-13(5-7-14)22(18,19)15-12-2-3-12/h4-7,12,15H,2-3,8-11H2,1H3/p+1 |
| InChIKey | RJPZFIBKQGWLEH-UHFFFAOYSA-O |
| XLogP | -1.35 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |