C17H28N3O4S2+ — CID 6972146
1-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]sulfonylpiperazin-1-ium (PubChem CID 6972146) has the molecular formula C17H28N3O4S2+ and a molecular weight of 402.56 g/mol. Its IUPAC name is 1-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]sulfonylpiperazin-1-ium.
| Compound Name | 1-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 6972146 |
| Molecular Formula | C17H28N3O4S2+ |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-methyl-4-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]sulfonylpiperazin-1-ium |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(S(=O)(=O)N3CC[NH+](C)CC3)cc2)CC1 |
| InChI | InChI=1S/C17H27N3O4S2/c1-15-7-9-19(10-8-15)25(21,22)16-3-5-17(6-4-16)26(23,24)20-13-11-18(2)12-14-20/h3-6,15H,7-14H2,1-2H3/p+1 |
| InChIKey | XMGZSKDFCPPUID-UHFFFAOYSA-O |
| XLogP | -0.37 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |