C12H18N2O4S2 — CID 841440
4-(4-methylpiperidin-1-yl)sulfonylbenzenesulfonamide (PubChem CID 841440) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-(4-methylpiperidin-1-yl)sulfonylbenzenesulfonamide.
| Compound Name | 4-(4-methylpiperidin-1-yl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 841440 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-(4-methylpiperidin-1-yl)sulfonylbenzenesulfonamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-10-6-8-14(9-7-10)20(17,18)12-4-2-11(3-5-12)19(13,15)16/h2-5,10H,6-9H2,1H3,(H2,13,15,16) |
| InChIKey | SMBDNZHKTNOBSJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |