C13H20N2O4S2 — CID 94176618
4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 94176618) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 94176618 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-10-7-11(2)9-15(8-10)21(18,19)13-5-3-12(4-6-13)20(14,16)17/h3-6,10-11H,7-9H2,1-2H3,(H2,14,16,17)/t10-,11-/m0/s1 |
| InChIKey | IWGMUCDPBTYHSB-QWRGUYRKSA-N |
| XLogP | 1.00 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |