C13H18N4O2S — CID 151718786
1-(4-azidophenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 151718786) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-(4-azidophenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | 1-(4-azidophenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 151718786 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(4-azidophenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(N=[N+]=[N-])cc2)C1 |
| InChI | InChI=1S/C13H18N4O2S/c1-10-7-11(2)9-17(8-10)20(18,19)13-5-3-12(4-6-13)15-16-14/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | RIDAJGTUGAQUFN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|