C13H19NO3S — CID 135044550
(3R,5S)-5-methyl-1-(4-methylphenyl)sulfonylpiperidin-3-ol (PubChem CID 135044550) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (3R,5S)-5-methyl-1-(4-methylphenyl)sulfonylpiperidin-3-ol.
| Compound Name | (3R,5S)-5-methyl-1-(4-methylphenyl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 135044550 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (3R,5S)-5-methyl-1-(4-methylphenyl)sulfonylpiperidin-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](C)C[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C13H19NO3S/c1-10-3-5-13(6-4-10)18(16,17)14-8-11(2)7-12(15)9-14/h3-6,11-12,15H,7-9H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | YRTWZBYCRNWXSE-NWDGAFQWSA-N |
| XLogP | 1.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |