C13H18FNO2S — CID 755984
(3R,5R)-1-(4-fluorophenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 755984) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is (3R,5R)-1-(4-fluorophenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | (3R,5R)-1-(4-fluorophenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 755984 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (3R,5R)-1-(4-fluorophenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | C[C@@H]1C[C@@H](C)CN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H18FNO2S/c1-10-7-11(2)9-15(8-10)18(16,17)13-5-3-12(14)4-6-13/h3-6,10-11H,7-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | RYELLTAFNDNSCL-GHMZBOCLSA-N |
| XLogP | 2.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |