C13H18ClNO4S2 — CID 50987777
4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzenesulfonyl chloride (PubChem CID 50987777) has the molecular formula C13H18ClNO4S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzenesulfonyl chloride.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 50987777 |
| Molecular Formula | C13H18ClNO4S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzenesulfonyl chloride |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(S(=O)(=O)Cl)cc2)C1 |
| InChI | InChI=1S/C13H18ClNO4S2/c1-10-7-11(2)9-15(8-10)21(18,19)13-5-3-12(4-6-13)20(14,16)17/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | NPLZZEGSEGSKMF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |